C18H28O2S — CID 11197601
6-(4-methylsulfanylphenyl)hexyl 2,2-dimethylpropanoate (PubChem CID 11197601) has the molecular formula C18H28O2S and a molecular weight of 308.49 g/mol. Its IUPAC name is 6-(4-methylsulfanylphenyl)hexyl 2,2-dimethylpropanoate.
| Compound Name | 6-(4-methylsulfanylphenyl)hexyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11197601 |
| Molecular Formula | C18H28O2S |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 6-(4-methylsulfanylphenyl)hexyl 2,2-dimethylpropanoate |
| SMILES | CSc1ccc(CCCCCCOC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H28O2S/c1-18(2,3)17(19)20-14-8-6-5-7-9-15-10-12-16(21-4)13-11-15/h10-13H,5-9,14H2,1-4H3 |
| InChIKey | OBAYPDXLEVYATB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|