C10H10ClF3N4O2 — CID 11197685
8-chloro-1-propyl-3-(2,2,2-trifluoroethyl)-7H-purine-2,6-dione (PubChem CID 11197685) has the molecular formula C10H10ClF3N4O2 and a molecular weight of 310.66 g/mol. Its IUPAC name is 8-chloro-1-propyl-3-(2,2,2-trifluoroethyl)-7H-purine-2,6-dione.
| Compound Name | 8-chloro-1-propyl-3-(2,2,2-trifluoroethyl)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 11197685 |
| Molecular Formula | C10H10ClF3N4O2 |
| Molecular Weight | 310.66 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 8-chloro-1-propyl-3-(2,2,2-trifluoroethyl)-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(Cl)nc2n(CC(F)(F)F)c1=O |
| InChI | InChI=1S/C10H10ClF3N4O2/c1-2-3-17-7(19)5-6(16-8(11)15-5)18(9(17)20)4-10(12,13)14/h2-4H2,1H3,(H,15,16) |
| InChIKey | NBDATXHOULWTFU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.66 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |