C15H12F3N3O2S — CID 1119769
4-methyl-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]benzenesulfonamide (PubChem CID 1119769) has the molecular formula C15H12F3N3O2S and a molecular weight of 355.34 g/mol. Its IUPAC name is 4-methyl-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 1119769 |
| Molecular Formula | C15H12F3N3O2S |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 4-methyl-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc3nc(C(F)(F)F)[nH]c3c2)cc1 |
| InChI | InChI=1S/C15H12F3N3O2S/c1-9-2-5-11(6-3-9)24(22,23)21-10-4-7-12-13(8-10)20-14(19-12)15(16,17)18/h2-8,21H,1H3,(H,19,20) |
| InChIKey | HBXAVFZGZVWFSM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |