C19H24N2O2 — CID 11197752
(3R)-3-[(2S,4S,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-3-(2-hydroxyethyl)-1H-indol-2-one (PubChem CID 11197752) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is (3R)-3-[(2S,4S,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-3-(2-hydroxyethyl)-1H-indol-2-one.
| Compound Name | (3R)-3-[(2S,4S,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-3-(2-hydroxyethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 11197752 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (3R)-3-[(2S,4S,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-3-(2-hydroxyethyl)-1H-indol-2-one |
| SMILES | C=C[C@@H]1CN2CC[C@H]1C[C@H]2[C@]1(CCO)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C19H24N2O2/c1-2-13-12-21-9-7-14(13)11-17(21)19(8-10-22)15-5-3-4-6-16(15)20-18(19)23/h2-6,13-14,17,22H,1,7-12H2,(H,20,23)/t13-,14+,17+,19-/m1/s1 |
| InChIKey | MUTOOCDUQXGEEC-MCPREKNCSA-N |
| XLogP | 2.16 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|