C19H22N4S — CID 111977674
1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methyl-3-(naphthalen-1-ylmethyl)guanidine (PubChem CID 111977674) has the molecular formula C19H22N4S and a molecular weight of 338.48 g/mol. Its IUPAC name is 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methyl-3-(naphthalen-1-ylmethyl)guanidine.
| Compound Name | 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methyl-3-(naphthalen-1-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111977674 |
| Molecular Formula | C19H22N4S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methyl-3-(naphthalen-1-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1sc(C)nc1C)NCc1cccc2ccccc12 |
| InChI | InChI=1S/C19H22N4S/c1-13-18(24-14(2)23-13)12-22-19(20-3)21-11-16-9-6-8-15-7-4-5-10-17(15)16/h4-10H,11-12H2,1-3H3,(H2,20,21,22) |
| InChIKey | NOQQGXMNWGOJLS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|