C25H31N5 — CID 111978008
1-ethyl-2-(naphthalen-1-ylmethyl)-3-[1-(pyridin-2-ylmethyl)piperidin-4-yl]guanidine (PubChem CID 111978008) has the molecular formula C25H31N5 and a molecular weight of 401.56 g/mol. Its IUPAC name is 1-ethyl-2-(naphthalen-1-ylmethyl)-3-[1-(pyridin-2-ylmethyl)piperidin-4-yl]guanidine.
| Compound Name | 1-ethyl-2-(naphthalen-1-ylmethyl)-3-[1-(pyridin-2-ylmethyl)piperidin-4-yl]guanidine |
|---|---|
| PubChem CID | 111978008 |
| Molecular Formula | C25H31N5 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | 1-ethyl-2-(naphthalen-1-ylmethyl)-3-[1-(pyridin-2-ylmethyl)piperidin-4-yl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc2ccccc12)NC1CCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C25H31N5/c1-2-26-25(28-18-21-10-7-9-20-8-3-4-12-24(20)21)29-22-13-16-30(17-14-22)19-23-11-5-6-15-27-23/h3-12,15,22H,2,13-14,16-19H2,1H3,(H2,26,28,29) |
| InChIKey | ISGRXDQLNBSKAB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|