C17H15F2N3O — CID 11197822
N-[4-(difluoromethoxy)phenyl]-N,2-dimethylquinazolin-4-amine (PubChem CID 11197822) has the molecular formula C17H15F2N3O and a molecular weight of 315.32 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-N,2-dimethylquinazolin-4-amine.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-N,2-dimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 11197822 |
| Molecular Formula | C17H15F2N3O |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-N,2-dimethylquinazolin-4-amine |
| SMILES | Cc1nc(N(C)c2ccc(OC(F)F)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C17H15F2N3O/c1-11-20-15-6-4-3-5-14(15)16(21-11)22(2)12-7-9-13(10-8-12)23-17(18)19/h3-10,17H,1-2H3 |
| InChIKey | GRXFCMYNVMQAGT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |