C24H35IN4 — CID 111978527
1-(1-cyclohexylpiperidin-4-yl)-2-methyl-3-(naphthalen-1-ylmethyl)guanidine;hydroiodide (PubChem CID 111978527) has the molecular formula C24H35IN4 and a molecular weight of 506.48 g/mol. Its IUPAC name is 1-(1-cyclohexylpiperidin-4-yl)-2-methyl-3-(naphthalen-1-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-(1-cyclohexylpiperidin-4-yl)-2-methyl-3-(naphthalen-1-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111978527 |
| Molecular Formula | C24H35IN4 |
| Molecular Weight | 506.48 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 1-(1-cyclohexylpiperidin-4-yl)-2-methyl-3-(naphthalen-1-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cccc2ccccc12)NC1CCN(C2CCCCC2)CC1.I |
| InChI | InChI=1S/C24H34N4.HI/c1-25-24(26-18-20-10-7-9-19-8-5-6-13-23(19)20)27-21-14-16-28(17-15-21)22-11-3-2-4-12-22;/h5-10,13,21-22H,2-4,11-12,14-18H2,1H3,(H2,25,26,27);1H |
| InChIKey | QOQAQISPUUUFFR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|