About [4-(trifluoromethyl)phenyl] 4-methylbenzenesulfonate
[4-(trifluoromethyl)phenyl] 4-methylbenzenesulfonate (PubChem CID 11197854) has the molecular formula C14H11F3O3S
and a molecular weight of 316.30 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [4-(trifluoromethyl)phenyl] 4-methylbenzenesulfonate |
| PubChem CID | 11197854 |
| Molecular Formula | C14H11F3O3S |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | [4-(trifluoromethyl)phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C14H11F3O3S/c1-10-2-8-13(9-3-10)21(18,19)20-12-6-4-11(5-7-12)14(15,16)17/h2-9H,1H3 |
| InChIKey | RWSSHLZCTGTMOT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(trifluoromethyl)phenyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(trifluoromethyl)phenyl] 4-methylbenzenesulfonate?
The IUPAC name of [4-(trifluoromethyl)phenyl] 4-methylbenzenesulfonate (CID 11197854) is [4-(trifluoromethyl)phenyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [4-(trifluoromethyl)phenyl] 4-methylbenzenesulfonate?
The canonical SMILES for [4-(trifluoromethyl)phenyl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)Oc2ccc(C(F)(F)F)cc2)cc1.
What is the InChIKey of [4-(trifluoromethyl)phenyl] 4-methylbenzenesulfonate?
The InChIKey is RWSSHLZCTGTMOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F3O3S/c1-10-2-8-13(9-3-10)21(18,19)20-12-6-4-11(5-7-12)14(15,16)17/h2-9H,1H3.
What are the key properties of [4-(trifluoromethyl)phenyl] 4-methylbenzenesulfonate?
[4-(trifluoromethyl)phenyl] 4-methylbenzenesulfonate has a molecular weight of 316.30 g/mol, XLogP of 3.78, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(trifluoromethyl)phenyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 11197854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).