C18H32N4O2S — CID 111980201
2-[2-(diethylsulfamoyl)ethyl]-3-ethyl-1-methyl-1-[(2-methylphenyl)methyl]guanidine (PubChem CID 111980201) has the molecular formula C18H32N4O2S and a molecular weight of 368.55 g/mol. Its IUPAC name is 2-[2-(diethylsulfamoyl)ethyl]-3-ethyl-1-methyl-1-[(2-methylphenyl)methyl]guanidine.
| Compound Name | 2-[2-(diethylsulfamoyl)ethyl]-3-ethyl-1-methyl-1-[(2-methylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111980201 |
| Molecular Formula | C18H32N4O2S |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 2-[2-(diethylsulfamoyl)ethyl]-3-ethyl-1-methyl-1-[(2-methylphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\CCS(=O)(=O)N(CC)CC)N(C)Cc1ccccc1C |
| InChI | InChI=1S/C18H32N4O2S/c1-6-19-18(20-13-14-25(23,24)22(7-2)8-3)21(5)15-17-12-10-9-11-16(17)4/h9-12H,6-8,13-15H2,1-5H3,(H,19,20) |
| InChIKey | ISIBGOSIRWEQAJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|