C11H12F6O4 — CID 11198038
bis(2,2,2-trifluoroethyl) 2,2-dimethylcyclopropane-1,1-dicarboxylate (PubChem CID 11198038) has the molecular formula C11H12F6O4 and a molecular weight of 322.20 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethyl) 2,2-dimethylcyclopropane-1,1-dicarboxylate.
| Compound Name | bis(2,2,2-trifluoroethyl) 2,2-dimethylcyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11198038 |
| Molecular Formula | C11H12F6O4 |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | bis(2,2,2-trifluoroethyl) 2,2-dimethylcyclopropane-1,1-dicarboxylate |
| SMILES | CC1(C)CC1(C(=O)OCC(F)(F)F)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C11H12F6O4/c1-8(2)3-9(8,6(18)20-4-10(12,13)14)7(19)21-5-11(15,16)17/h3-5H2,1-2H3 |
| InChIKey | DRHGOKZMJQYRDN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|