C20H34O3 — CID 11198071
(2E,7E,10E,14E)-2,6,10,14-tetramethylhexadeca-2,7,10,14-tetraene-1,6,16-triol (PubChem CID 11198071) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (2E,7E,10E,14E)-2,6,10,14-tetramethylhexadeca-2,7,10,14-tetraene-1,6,16-triol.
| Compound Name | (2E,7E,10E,14E)-2,6,10,14-tetramethylhexadeca-2,7,10,14-tetraene-1,6,16-triol |
|---|---|
| PubChem CID | 11198071 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (2E,7E,10E,14E)-2,6,10,14-tetramethylhexadeca-2,7,10,14-tetraene-1,6,16-triol |
| SMILES | C/C(=C\CCC(C)(O)/C=C/C/C(C)=C/CC/C(C)=C/CO)CO |
| InChI | InChI=1S/C20H34O3/c1-17(8-5-9-18(2)12-15-21)10-6-13-20(4,23)14-7-11-19(3)16-22/h6,8,11-13,21-23H,5,7,9-10,14-16H2,1-4H3/b13-6+,17-8+,18-12+,19-11+ |
| InChIKey | QVPAFHFVRMUTMO-AOMRLLSLSA-N |
| XLogP | 4.07 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|