About [4-(benzenesulfonyl)-4,4-difluorobutoxy]benzene
[4-(benzenesulfonyl)-4,4-difluorobutoxy]benzene (PubChem CID 11198172) has the molecular formula C16H16F2O3S
and a molecular weight of 326.36 g/mol. Its IUPAC name is [4-(benzenesulfonyl)-4,4-difluorobutoxy]benzene.
Molecular Properties
| Compound Name | [4-(benzenesulfonyl)-4,4-difluorobutoxy]benzene |
| PubChem CID | 11198172 |
| Molecular Formula | C16H16F2O3S |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | [4-(benzenesulfonyl)-4,4-difluorobutoxy]benzene |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)CCCOc1ccccc1 |
| InChI | InChI=1S/C16H16F2O3S/c17-16(18,22(19,20)15-10-5-2-6-11-15)12-7-13-21-14-8-3-1-4-9-14/h1-6,8-11H,7,12-13H2 |
| InChIKey | GFGXWWMMRIOQDX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [4-(benzenesulfonyl)-4,4-difluorobutoxy]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(benzenesulfonyl)-4,4-difluorobutoxy]benzene?
The IUPAC name of [4-(benzenesulfonyl)-4,4-difluorobutoxy]benzene (CID 11198172) is [4-(benzenesulfonyl)-4,4-difluorobutoxy]benzene.
What is the SMILES notation for [4-(benzenesulfonyl)-4,4-difluorobutoxy]benzene?
The canonical SMILES for [4-(benzenesulfonyl)-4,4-difluorobutoxy]benzene is O=S(=O)(c1ccccc1)C(F)(F)CCCOc1ccccc1.
What is the InChIKey of [4-(benzenesulfonyl)-4,4-difluorobutoxy]benzene?
The InChIKey is GFGXWWMMRIOQDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F2O3S/c17-16(18,22(19,20)15-10-5-2-6-11-15)12-7-13-21-14-8-3-1-4-9-14/h1-6,8-11H,7,12-13H2.
What are the key properties of [4-(benzenesulfonyl)-4,4-difluorobutoxy]benzene?
[4-(benzenesulfonyl)-4,4-difluorobutoxy]benzene has a molecular weight of 326.36 g/mol, XLogP of 3.91, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(benzenesulfonyl)-4,4-difluorobutoxy]benzene is sourced from PubChem (CID 11198172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).