C18H30O5 — CID 11198178
(5R,5aR,7aS,11R,11aR,11bS)-5,11a-dihydroxy-2,2,5,7a,11-pentamethyl-4,5a,6,7,8,9,11,11b-octahydronaphtho[1,2-d][1,3]dioxepin-10-one (PubChem CID 11198178) has the molecular formula C18H30O5 and a molecular weight of 326.43 g/mol. Its IUPAC name is (5R,5aR,7aS,11R,11aR,11bS)-5,11a-dihydroxy-2,2,5,7a,11-pentamethyl-4,5a,6,7,8,9,11,11b-octahydronaphtho[1,2-d][1,3]dioxepin-10-one.
| Compound Name | (5R,5aR,7aS,11R,11aR,11bS)-5,11a-dihydroxy-2,2,5,7a,11-pentamethyl-4,5a,6,7,8,9,11,11b-octahydronaphtho[1,2-d][1,3]dioxepin-10-one |
|---|---|
| PubChem CID | 11198178 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | (5R,5aR,7aS,11R,11aR,11bS)-5,11a-dihydroxy-2,2,5,7a,11-pentamethyl-4,5a,6,7,8,9,11,11b-octahydronaphtho[1,2-d][1,3]dioxepin-10-one |
| SMILES | C[C@H]1C(=O)CC[C@]2(C)CC[C@@H]3[C@H](OC(C)(C)OC[C@]3(C)O)[C@@]12O |
| InChI | InChI=1S/C18H30O5/c1-11-13(19)7-9-16(4)8-6-12-14(18(11,16)21)23-15(2,3)22-10-17(12,5)20/h11-12,14,20-21H,6-10H2,1-5H3/t11-,12+,14-,16-,17-,18-/m0/s1 |
| InChIKey | HNUQNPQDIRQFQH-PFAGNYMBSA-N |
| XLogP | 2.04 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |