C19H39IN6O — CID 111981886
2-[3-[di(propan-2-yl)amino]propyl]-1-ethyl-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide (PubChem CID 111981886) has the molecular formula C19H39IN6O and a molecular weight of 494.47 g/mol. Its IUPAC name is 2-[3-[di(propan-2-yl)amino]propyl]-1-ethyl-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[3-[di(propan-2-yl)amino]propyl]-1-ethyl-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111981886 |
| Molecular Formula | C19H39IN6O |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 2-[3-[di(propan-2-yl)amino]propyl]-1-ethyl-3-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN(C(C)C)C(C)C)NCCc1nc(C(C)C)no1.I |
| InChI | InChI=1S/C19H38N6O.HI/c1-8-20-19(21-11-9-13-25(15(4)5)16(6)7)22-12-10-17-23-18(14(2)3)24-26-17;/h14-16H,8-13H2,1-7H3,(H2,20,21,22);1H |
| InChIKey | MVWFDXHLWSTRLP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 78.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|