C17H27FIN3OS — CID 111982452
1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide (PubChem CID 111982452) has the molecular formula C17H27FIN3OS and a molecular weight of 467.39 g/mol. Its IUPAC name is 1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111982452 |
| Molecular Formula | C17H27FIN3OS |
| Molecular Weight | 467.39 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | 1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(C)Oc1ccc(F)cc1)NC1CCC(SC)C1.I |
| InChI | InChI=1S/C17H26FN3OS.HI/c1-12(22-15-7-4-13(18)5-8-15)11-20-17(19-2)21-14-6-9-16(10-14)23-3;/h4-5,7-8,12,14,16H,6,9-11H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | KHJAWSQLYALKAQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|