C15H12ClN5S — CID 11198278
N-(6-chloro-3-pyridinyl)-2-methyl-4,5-dihydro-[1,3]thiazolo[4,5-h]quinazolin-8-amine (PubChem CID 11198278) has the molecular formula C15H12ClN5S and a molecular weight of 329.82 g/mol. Its IUPAC name is N-(6-chloro-3-pyridinyl)-2-methyl-4,5-dihydro-[1,3]thiazolo[4,5-h]quinazolin-8-amine.
| Compound Name | N-(6-chloro-3-pyridinyl)-2-methyl-4,5-dihydro-[1,3]thiazolo[4,5-h]quinazolin-8-amine |
|---|---|
| PubChem CID | 11198278 |
| Molecular Formula | C15H12ClN5S |
| Molecular Weight | 329.82 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | N-(6-chloro-3-pyridinyl)-2-methyl-4,5-dihydro-[1,3]thiazolo[4,5-h]quinazolin-8-amine |
| SMILES | Cc1nc2c(s1)-c1nc(Nc3ccc(Cl)nc3)ncc1CC2 |
| InChI | InChI=1S/C15H12ClN5S/c1-8-19-11-4-2-9-6-18-15(21-13(9)14(11)22-8)20-10-3-5-12(16)17-7-10/h3,5-7H,2,4H2,1H3,(H,18,20,21) |
| InChIKey | ANWMSXOBKGKAOJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.82 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|