C19H19F4N3O — CID 111982893
2-methyl-1-[(2-prop-2-enoxyphenyl)methyl]-3-[(2,3,5,6-tetrafluorophenyl)methyl]guanidine (PubChem CID 111982893) has the molecular formula C19H19F4N3O and a molecular weight of 381.37 g/mol. Its IUPAC name is 2-methyl-1-[(2-prop-2-enoxyphenyl)methyl]-3-[(2,3,5,6-tetrafluorophenyl)methyl]guanidine.
| Compound Name | 2-methyl-1-[(2-prop-2-enoxyphenyl)methyl]-3-[(2,3,5,6-tetrafluorophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111982893 |
| Molecular Formula | C19H19F4N3O |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-methyl-1-[(2-prop-2-enoxyphenyl)methyl]-3-[(2,3,5,6-tetrafluorophenyl)methyl]guanidine |
| SMILES | C=CCOc1ccccc1CN/C(=N\C)NCc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C19H19F4N3O/c1-3-8-27-16-7-5-4-6-12(16)10-25-19(24-2)26-11-13-17(22)14(20)9-15(21)18(13)23/h3-7,9H,1,8,10-11H2,2H3,(H2,24,25,26) |
| InChIKey | ICSYMRRJKJVOBG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|