C20H31N3O2S — CID 111983323
1-ethyl-3-[(2-ethylsulfanyl-1-hydroxycyclobutyl)methyl]-2-[(2-prop-2-enoxyphenyl)methyl]guanidine (PubChem CID 111983323) has the molecular formula C20H31N3O2S and a molecular weight of 377.55 g/mol. Its IUPAC name is 1-ethyl-3-[(2-ethylsulfanyl-1-hydroxycyclobutyl)methyl]-2-[(2-prop-2-enoxyphenyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[(2-ethylsulfanyl-1-hydroxycyclobutyl)methyl]-2-[(2-prop-2-enoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111983323 |
| Molecular Formula | C20H31N3O2S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 1-ethyl-3-[(2-ethylsulfanyl-1-hydroxycyclobutyl)methyl]-2-[(2-prop-2-enoxyphenyl)methyl]guanidine |
| SMILES | C=CCOc1ccccc1C/N=C(\NCC)NCC1(O)CCC1SCC |
| InChI | InChI=1S/C20H31N3O2S/c1-4-13-25-17-10-8-7-9-16(17)14-22-19(21-5-2)23-15-20(24)12-11-18(20)26-6-3/h4,7-10,18,24H,1,5-6,11-15H2,2-3H3,(H2,21,22,23) |
| InChIKey | KEADSSAHLKNUEP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|