C20H33IN4O — CID 111983444
1-[2-[cyclopentyl(methyl)amino]ethyl]-2-methyl-3-[(2-prop-2-enoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111983444) has the molecular formula C20H33IN4O and a molecular weight of 472.42 g/mol. Its IUPAC name is 1-[2-[cyclopentyl(methyl)amino]ethyl]-2-methyl-3-[(2-prop-2-enoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[cyclopentyl(methyl)amino]ethyl]-2-methyl-3-[(2-prop-2-enoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111983444 |
| Molecular Formula | C20H33IN4O |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 1-[2-[cyclopentyl(methyl)amino]ethyl]-2-methyl-3-[(2-prop-2-enoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C=CCOc1ccccc1CN/C(=N/C)NCCN(C)C1CCCC1.I |
| InChI | InChI=1S/C20H32N4O.HI/c1-4-15-25-19-12-8-5-9-17(19)16-23-20(21-2)22-13-14-24(3)18-10-6-7-11-18;/h4-5,8-9,12,18H,1,6-7,10-11,13-16H2,2-3H3,(H2,21,22,23);1H |
| InChIKey | LRNCOMPSTPNPHC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|