C20H22N4OS — CID 1119840
12-ethyl-16-sulfanylidenespiro[12,14,15,17-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,13-pentaene-9,1'-cyclohexane]-11-one (PubChem CID 1119840) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 12-ethyl-16-sulfanylidenespiro[12,14,15,17-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,13-pentaene-9,1'-cyclohexane]-11-one.
| Compound Name | 12-ethyl-16-sulfanylidenespiro[12,14,15,17-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,13-pentaene-9,1'-cyclohexane]-11-one |
|---|---|
| PubChem CID | 1119840 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 12-ethyl-16-sulfanylidenespiro[12,14,15,17-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,13-pentaene-9,1'-cyclohexane]-11-one |
| SMILES | CCn1c(=O)c2c(n3c(=S)[nH]nc13)-c1ccccc1CC21CCCCC1 |
| InChI | InChI=1S/C20H22N4OS/c1-2-23-17(25)15-16(24-18(23)21-22-19(24)26)14-9-5-4-8-13(14)12-20(15)10-6-3-7-11-20/h4-5,8-9H,2-3,6-7,10-12H2,1H3,(H,22,26) |
| InChIKey | DEQBYTRDRTXHTA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|