C16H22N4O4 — CID 11198412
(1S,8R,10S,17R,18S,19S)-5,14-dihydroxy-2,7,11,16-tetrazahexacyclo[15.2.1.02,7.08,19.010,18.011,16]icosane-3,12-dione (PubChem CID 11198412) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is (1S,8R,10S,17R,18S,19S)-5,14-dihydroxy-2,7,11,16-tetrazahexacyclo[15.2.1.02,7.08,19.010,18.011,16]icosane-3,12-dione.
| Compound Name | (1S,8R,10S,17R,18S,19S)-5,14-dihydroxy-2,7,11,16-tetrazahexacyclo[15.2.1.02,7.08,19.010,18.011,16]icosane-3,12-dione |
|---|---|
| PubChem CID | 11198412 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | (1S,8R,10S,17R,18S,19S)-5,14-dihydroxy-2,7,11,16-tetrazahexacyclo[15.2.1.02,7.08,19.010,18.011,16]icosane-3,12-dione |
| SMILES | O=C1CC(O)CN2[C@@H]3C[C@H]4[C@H]5[C@@H]3[C@H](C[C@H]5N3CC(O)CC(=O)N43)N12 |
| InChI | InChI=1S/C16H22N4O4/c21-7-1-13(23)19-11-3-10-16-12(4-9(15(11)16)17(19)5-7)20-14(24)2-8(22)6-18(10)20/h7-12,15-16,21-22H,1-6H2/t7?,8?,9-,10-,11+,12+,15+,16+/m1/s1 |
| InChIKey | IGICCIKFPQIQSU-RQXADFFQSA-N |
| XLogP | -1.85 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |