C11H18BrF4NO — CID 11198458
2-bromo-N,N-dibutyl-2,3,3,3-tetrafluoropropanamide (PubChem CID 11198458) has the molecular formula C11H18BrF4NO and a molecular weight of 336.17 g/mol. Its IUPAC name is 2-bromo-N,N-dibutyl-2,3,3,3-tetrafluoropropanamide.
| Compound Name | 2-bromo-N,N-dibutyl-2,3,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 11198458 |
| Molecular Formula | C11H18BrF4NO |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 2-bromo-N,N-dibutyl-2,3,3,3-tetrafluoropropanamide |
| SMILES | CCCCN(CCCC)C(=O)C(F)(Br)C(F)(F)F |
| InChI | InChI=1S/C11H18BrF4NO/c1-3-5-7-17(8-6-4-2)9(18)10(12,13)11(14,15)16/h3-8H2,1-2H3 |
| InChIKey | DUZMZNQLMHLQBU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|