About (5E)-2-cyclopropyl-10-methyl-6-(oxan-2-yloxymethyl)undeca-5,9-dien-2-ol
(5E)-2-cyclopropyl-10-methyl-6-(oxan-2-yloxymethyl)undeca-5,9-dien-2-ol (PubChem CID 11198488) has the molecular formula C21H36O3
and a molecular weight of 336.52 g/mol. Its IUPAC name is (5E)-2-cyclopropyl-10-methyl-6-(oxan-2-yloxymethyl)undeca-5,9-dien-2-ol.
Molecular Properties
| Compound Name | (5E)-2-cyclopropyl-10-methyl-6-(oxan-2-yloxymethyl)undeca-5,9-dien-2-ol |
| PubChem CID | 11198488 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | (5E)-2-cyclopropyl-10-methyl-6-(oxan-2-yloxymethyl)undeca-5,9-dien-2-ol |
| SMILES | CC(C)=CCC/C(=C\CCC(C)(O)C1CC1)COC1CCCCO1 |
| InChI | InChI=1S/C21H36O3/c1-17(2)8-6-9-18(16-24-20-11-4-5-15-23-20)10-7-14-21(3,22)19-12-13-19/h8,10,19-20,22H,4-7,9,11-16H2,1-3H3/b18-10+ |
| InChIKey | OBQDTTDXKXXKNP-VCHYOVAHSA-N |
| XLogP | 5.14 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-2-cyclopropyl-10-methyl-6-(oxan-2-yloxymethyl)undeca-5,9-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-2-cyclopropyl-10-methyl-6-(oxan-2-yloxymethyl)undeca-5,9-dien-2-ol?
The IUPAC name of (5E)-2-cyclopropyl-10-methyl-6-(oxan-2-yloxymethyl)undeca-5,9-dien-2-ol (CID 11198488) is (5E)-2-cyclopropyl-10-methyl-6-(oxan-2-yloxymethyl)undeca-5,9-dien-2-ol.
What is the SMILES notation for (5E)-2-cyclopropyl-10-methyl-6-(oxan-2-yloxymethyl)undeca-5,9-dien-2-ol?
The canonical SMILES for (5E)-2-cyclopropyl-10-methyl-6-(oxan-2-yloxymethyl)undeca-5,9-dien-2-ol is CC(C)=CCC/C(=C\CCC(C)(O)C1CC1)COC1CCCCO1.
What is the InChIKey of (5E)-2-cyclopropyl-10-methyl-6-(oxan-2-yloxymethyl)undeca-5,9-dien-2-ol?
The InChIKey is OBQDTTDXKXXKNP-VCHYOVAHSA-N. The full InChI is InChI=1S/C21H36O3/c1-17(2)8-6-9-18(16-24-20-11-4-5-15-23-20)10-7-14-21(3,22)19-12-13-19/h8,10,19-20,22H,4-7,9,11-16H2,1-3H3/b18-10+.
What are the key properties of (5E)-2-cyclopropyl-10-methyl-6-(oxan-2-yloxymethyl)undeca-5,9-dien-2-ol?
(5E)-2-cyclopropyl-10-methyl-6-(oxan-2-yloxymethyl)undeca-5,9-dien-2-ol has a molecular weight of 336.52 g/mol, XLogP of 5.14, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-2-cyclopropyl-10-methyl-6-(oxan-2-yloxymethyl)undeca-5,9-dien-2-ol is sourced from PubChem (CID 11198488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).