About tert-butyl 6-iodo-2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate
tert-butyl 6-iodo-2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate (PubChem CID 11198502) has the molecular formula C11H16INO3
and a molecular weight of 337.16 g/mol. Its IUPAC name is tert-butyl 6-iodo-2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 6-iodo-2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate |
| PubChem CID | 11198502 |
| Molecular Formula | C11H16INO3 |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | tert-butyl 6-iodo-2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate |
| SMILES | CC1CC(=O)C=C(I)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H16INO3/c1-7-5-8(14)6-9(12)13(7)10(15)16-11(2,3)4/h6-7H,5H2,1-4H3 |
| InChIKey | QBPHLQNNUSAILL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 6-iodo-2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6-iodo-2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate?
The IUPAC name of tert-butyl 6-iodo-2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate (CID 11198502) is tert-butyl 6-iodo-2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate.
What is the SMILES notation for tert-butyl 6-iodo-2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate?
The canonical SMILES for tert-butyl 6-iodo-2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate is CC1CC(=O)C=C(I)N1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 6-iodo-2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate?
The InChIKey is QBPHLQNNUSAILL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16INO3/c1-7-5-8(14)6-9(12)13(7)10(15)16-11(2,3)4/h6-7H,5H2,1-4H3.
What are the key properties of tert-butyl 6-iodo-2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate?
tert-butyl 6-iodo-2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate has a molecular weight of 337.16 g/mol, XLogP of 2.86, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6-iodo-2-methyl-4-oxo-2,3-dihydropyridine-1-carboxylate is sourced from PubChem (CID 11198502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).