C24H36IN5O — CID 111985036
1-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-3-[1-(2-methoxy-5-methylphenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111985036) has the molecular formula C24H36IN5O and a molecular weight of 537.49 g/mol. Its IUPAC name is 1-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-3-[1-(2-methoxy-5-methylphenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-3-[1-(2-methoxy-5-methylphenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111985036 |
| Molecular Formula | C24H36IN5O |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | 1-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-3-[1-(2-methoxy-5-methylphenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccnc(N2CCCCCC2)c1)NC(C)c1cc(C)ccc1OC.I |
| InChI | InChI=1S/C24H35N5O.HI/c1-18-9-10-22(30-4)21(15-18)19(2)28-24(25-3)27-17-20-11-12-26-23(16-20)29-13-7-5-6-8-14-29;/h9-12,15-16,19H,5-8,13-14,17H2,1-4H3,(H2,25,27,28);1H |
| InChIKey | HKZRKMBDSUITNL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|