C17H27IN4O2S — CID 111985318
2-[3-[[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide (PubChem CID 111985318) has the molecular formula C17H27IN4O2S and a molecular weight of 478.40 g/mol. Its IUPAC name is 2-[3-[[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide.
| Compound Name | 2-[3-[[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111985318 |
| Molecular Formula | C17H27IN4O2S |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 2-[3-[[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(OCC(N)=O)c1)NC1CCC(SC)C1.I |
| InChI | InChI=1S/C17H26N4O2S.HI/c1-19-17(21-13-6-7-15(9-13)24-2)20-10-12-4-3-5-14(8-12)23-11-16(18)22;/h3-5,8,13,15H,6-7,9-11H2,1-2H3,(H2,18,22)(H2,19,20,21);1H |
| InChIKey | GZVUTDBRDPEBSA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|