C17H24O7 — CID 11198586
dimethyl (1S,2R,3S,4R)-1-(5-ethoxy-5-oxopentyl)-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 11198586) has the molecular formula C17H24O7 and a molecular weight of 340.37 g/mol. Its IUPAC name is dimethyl (1S,2R,3S,4R)-1-(5-ethoxy-5-oxopentyl)-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | dimethyl (1S,2R,3S,4R)-1-(5-ethoxy-5-oxopentyl)-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11198586 |
| Molecular Formula | C17H24O7 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | dimethyl (1S,2R,3S,4R)-1-(5-ethoxy-5-oxopentyl)-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | CCOC(=O)CCCC[C@@]12C=C[C@@H](O1)[C@@H](C(=O)OC)[C@H]2C(=O)OC |
| InChI | InChI=1S/C17H24O7/c1-4-23-12(18)7-5-6-9-17-10-8-11(24-17)13(15(19)21-2)14(17)16(20)22-3/h8,10-11,13-14H,4-7,9H2,1-3H3/t11-,13-,14+,17+/m1/s1 |
| InChIKey | CCIBBLQSNAEFOX-CVGURMSBSA-N |
| XLogP | 1.40 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|