C18H26FIN4O2 — CID 111985966
1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111985966) has the molecular formula C18H26FIN4O2 and a molecular weight of 476.33 g/mol. Its IUPAC name is 1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111985966 |
| Molecular Formula | C18H26FIN4O2 |
| Molecular Weight | 476.33 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cc(C(C)C)no1)NCC(C)Oc1ccc(F)cc1.I |
| InChI | InChI=1S/C18H25FN4O2.HI/c1-12(2)17-9-16(25-23-17)11-22-18(20-4)21-10-13(3)24-15-7-5-14(19)6-8-15;/h5-9,12-13H,10-11H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | DVVPLZZRRFPZPV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|