C17H27F5O — CID 11198653
1-(1,1,2,2,2-pentafluoroethoxy)-4-(4-propylcyclohexyl)cyclohexane (PubChem CID 11198653) has the molecular formula C17H27F5O and a molecular weight of 342.39 g/mol. Its IUPAC name is 1-(1,1,2,2,2-pentafluoroethoxy)-4-(4-propylcyclohexyl)cyclohexane.
| Compound Name | 1-(1,1,2,2,2-pentafluoroethoxy)-4-(4-propylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 11198653 |
| Molecular Formula | C17H27F5O |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 1-(1,1,2,2,2-pentafluoroethoxy)-4-(4-propylcyclohexyl)cyclohexane |
| SMILES | CCCC1CCC(C2CCC(OC(F)(F)C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C17H27F5O/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(11-9-14)23-17(21,22)16(18,19)20/h12-15H,2-11H2,1H3 |
| InChIKey | AFCZQMWHQFVECM-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|