C22H30O3 — CID 11198667
2-methoxy-3,5-dimethyl-6-[(2E,4Z,6E,8E)-4,6,8-trimethylundeca-2,4,6,8-tetraen-2-yl]pyran-4-one (PubChem CID 11198667) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is 2-methoxy-3,5-dimethyl-6-[(2E,4Z,6E,8E)-4,6,8-trimethylundeca-2,4,6,8-tetraen-2-yl]pyran-4-one.
| Compound Name | 2-methoxy-3,5-dimethyl-6-[(2E,4Z,6E,8E)-4,6,8-trimethylundeca-2,4,6,8-tetraen-2-yl]pyran-4-one |
|---|---|
| PubChem CID | 11198667 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 2-methoxy-3,5-dimethyl-6-[(2E,4Z,6E,8E)-4,6,8-trimethylundeca-2,4,6,8-tetraen-2-yl]pyran-4-one |
| SMILES | CC/C=C(C)/C=C(C)/C=C(C)\C=C(/C)c1oc(OC)c(C)c(=O)c1C |
| InChI | InChI=1S/C22H30O3/c1-9-10-14(2)11-15(3)12-16(4)13-17(5)21-18(6)20(23)19(7)22(24-8)25-21/h10-13H,9H2,1-8H3/b14-10+,15-11+,16-12-,17-13+ |
| InChIKey | LPJARWCVCZFBKP-FSAXCFAZSA-N |
| XLogP | 5.92 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|