C18H32FIN4O2 — CID 111986896
1-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine;hydroiodide (PubChem CID 111986896) has the molecular formula C18H32FIN4O2 and a molecular weight of 482.38 g/mol. Its IUPAC name is 1-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111986896 |
| Molecular Formula | C18H32FIN4O2 |
| Molecular Weight | 482.38 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 1-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(F)cc1)NCCN(C)CCCOC.I |
| InChI | InChI=1S/C18H31FN4O2.HI/c1-4-20-18(21-10-12-23(2)11-5-13-25-3)22-14-17(24)15-6-8-16(19)9-7-15;/h6-9,17,24H,4-5,10-14H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | HWSHDBWKCOVMLP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|