C17H28O7 — CID 11198718
tert-butyl [(3S,5R)-5-methoxy-4,4-dimethyl-5-[(4R)-6-oxo-1,3-dioxan-4-yl]pent-1-en-3-yl] carbonate (PubChem CID 11198718) has the molecular formula C17H28O7 and a molecular weight of 344.40 g/mol. Its IUPAC name is tert-butyl [(3S,5R)-5-methoxy-4,4-dimethyl-5-[(4R)-6-oxo-1,3-dioxan-4-yl]pent-1-en-3-yl] carbonate.
| Compound Name | tert-butyl [(3S,5R)-5-methoxy-4,4-dimethyl-5-[(4R)-6-oxo-1,3-dioxan-4-yl]pent-1-en-3-yl] carbonate |
|---|---|
| PubChem CID | 11198718 |
| Molecular Formula | C17H28O7 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | tert-butyl [(3S,5R)-5-methoxy-4,4-dimethyl-5-[(4R)-6-oxo-1,3-dioxan-4-yl]pent-1-en-3-yl] carbonate |
| SMILES | C=C[C@H](OC(=O)OC(C)(C)C)C(C)(C)[C@@H](OC)[C@H]1CC(=O)OCO1 |
| InChI | InChI=1S/C17H28O7/c1-8-12(23-15(19)24-16(2,3)4)17(5,6)14(20-7)11-9-13(18)22-10-21-11/h8,11-12,14H,1,9-10H2,2-7H3/t11-,12+,14+/m1/s1 |
| InChIKey | HAGLXHPOEHSYIK-DYEKYZERSA-N |
| XLogP | 2.82 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|