C22H38OSi — CID 11198805
[(1S)-1-[(1R,2R)-2-(2-phenylethyl)cyclopropyl]ethoxy]-tri(propan-2-yl)silane (PubChem CID 11198805) has the molecular formula C22H38OSi and a molecular weight of 346.63 g/mol. Its IUPAC name is [(1S)-1-[(1R,2R)-2-(2-phenylethyl)cyclopropyl]ethoxy]-tri(propan-2-yl)silane.
| Compound Name | [(1S)-1-[(1R,2R)-2-(2-phenylethyl)cyclopropyl]ethoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11198805 |
| Molecular Formula | C22H38OSi |
| Molecular Weight | 346.63 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | [(1S)-1-[(1R,2R)-2-(2-phenylethyl)cyclopropyl]ethoxy]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](O[C@@H](C)[C@@H]1C[C@H]1CCc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H38OSi/c1-16(2)24(17(3)4,18(5)6)23-19(7)22-15-21(22)14-13-20-11-9-8-10-12-20/h8-12,16-19,21-22H,13-15H2,1-7H3/t19-,21+,22-/m0/s1 |
| InChIKey | ZTROULISUMSFDR-NNWRFLSQSA-N |
| XLogP | 6.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.63 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|