C20H17N3O3 — CID 11198818
1-[[(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl]methyl]pyrimidine-2,4-dione (PubChem CID 11198818) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is 1-[[(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl]methyl]pyrimidine-2,4-dione.
| Compound Name | 1-[[(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11198818 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 1-[[(3S,4R)-2-oxo-1,4-diphenylazetidin-3-yl]methyl]pyrimidine-2,4-dione |
| SMILES | O=C1[C@@H](Cn2ccc(=O)[nH]c2=O)[C@H](c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C20H17N3O3/c24-17-11-12-22(20(26)21-17)13-16-18(14-7-3-1-4-8-14)23(19(16)25)15-9-5-2-6-10-15/h1-12,16,18H,13H2,(H,21,24,26)/t16-,18-/m0/s1 |
| InChIKey | MIBUJJUGXPKEBO-WMZOPIPTSA-N |
| XLogP | 1.94 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |