C18H36S3 — CID 11198864
2,4,6-tris(3-methylbutyl)-1,3,5-trithiane (PubChem CID 11198864) has the molecular formula C18H36S3 and a molecular weight of 348.69 g/mol. Its IUPAC name is 2,4,6-tris(3-methylbutyl)-1,3,5-trithiane.
| Compound Name | 2,4,6-tris(3-methylbutyl)-1,3,5-trithiane |
|---|---|
| PubChem CID | 11198864 |
| Molecular Formula | C18H36S3 |
| Molecular Weight | 348.69 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2,4,6-tris(3-methylbutyl)-1,3,5-trithiane |
| SMILES | CC(C)CCC1SC(CCC(C)C)SC(CCC(C)C)S1 |
| InChI | InChI=1S/C18H36S3/c1-13(2)7-10-16-19-17(11-8-14(3)4)21-18(20-16)12-9-15(5)6/h13-18H,7-12H2,1-6H3 |
| InChIKey | NTXLGTSNINCLPB-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.69 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |