C17H20O8 — CID 11198951
8-O-ethyl 9-O,10-O-dimethyl (1R,5R,8R)-7-oxo-11-oxatricyclo[6.2.1.01,5]undec-9-ene-8,9,10-tricarboxylate (PubChem CID 11198951) has the molecular formula C17H20O8 and a molecular weight of 352.34 g/mol. Its IUPAC name is 8-O-ethyl 9-O,10-O-dimethyl (1R,5R,8R)-7-oxo-11-oxatricyclo[6.2.1.01,5]undec-9-ene-8,9,10-tricarboxylate.
| Compound Name | 8-O-ethyl 9-O,10-O-dimethyl (1R,5R,8R)-7-oxo-11-oxatricyclo[6.2.1.01,5]undec-9-ene-8,9,10-tricarboxylate |
|---|---|
| PubChem CID | 11198951 |
| Molecular Formula | C17H20O8 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 8-O-ethyl 9-O,10-O-dimethyl (1R,5R,8R)-7-oxo-11-oxatricyclo[6.2.1.01,5]undec-9-ene-8,9,10-tricarboxylate |
| SMILES | CCOC(=O)[C@]12O[C@@]3(CCC[C@@H]3CC1=O)C(C(=O)OC)=C2C(=O)OC |
| InChI | InChI=1S/C17H20O8/c1-4-24-15(21)17-10(18)8-9-6-5-7-16(9,25-17)11(13(19)22-2)12(17)14(20)23-3/h9H,4-8H2,1-3H3/t9-,16-,17+/m1/s1 |
| InChIKey | QIBJLOPSJNICTQ-TVNTUTRRSA-N |
| XLogP | 0.47 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|