About 2-(2-oxo-5-phenyl-1,3-benzoxazol-3-yl)-N,N-dipropylacetamide
2-(2-oxo-5-phenyl-1,3-benzoxazol-3-yl)-N,N-dipropylacetamide (PubChem CID 11198965) has the molecular formula C21H24N2O3
and a molecular weight of 352.43 g/mol. Its IUPAC name is 2-(2-oxo-5-phenyl-1,3-benzoxazol-3-yl)-N,N-dipropylacetamide.
Molecular Properties
| Compound Name | 2-(2-oxo-5-phenyl-1,3-benzoxazol-3-yl)-N,N-dipropylacetamide |
| PubChem CID | 11198965 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 2-(2-oxo-5-phenyl-1,3-benzoxazol-3-yl)-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)Cn1c(=O)oc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C21H24N2O3/c1-3-12-22(13-4-2)20(24)15-23-18-14-17(16-8-6-5-7-9-16)10-11-19(18)26-21(23)25/h5-11,14H,3-4,12-13,15H2,1-2H3 |
| InChIKey | CREZVEBWPAIMPN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-oxo-5-phenyl-1,3-benzoxazol-3-yl)-N,N-dipropylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-oxo-5-phenyl-1,3-benzoxazol-3-yl)-N,N-dipropylacetamide?
The IUPAC name of 2-(2-oxo-5-phenyl-1,3-benzoxazol-3-yl)-N,N-dipropylacetamide (CID 11198965) is 2-(2-oxo-5-phenyl-1,3-benzoxazol-3-yl)-N,N-dipropylacetamide.
What is the SMILES notation for 2-(2-oxo-5-phenyl-1,3-benzoxazol-3-yl)-N,N-dipropylacetamide?
The canonical SMILES for 2-(2-oxo-5-phenyl-1,3-benzoxazol-3-yl)-N,N-dipropylacetamide is CCCN(CCC)C(=O)Cn1c(=O)oc2ccc(-c3ccccc3)cc21.
What is the InChIKey of 2-(2-oxo-5-phenyl-1,3-benzoxazol-3-yl)-N,N-dipropylacetamide?
The InChIKey is CREZVEBWPAIMPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O3/c1-3-12-22(13-4-2)20(24)15-23-18-14-17(16-8-6-5-7-9-16)10-11-19(18)26-21(23)25/h5-11,14H,3-4,12-13,15H2,1-2H3.
What are the key properties of 2-(2-oxo-5-phenyl-1,3-benzoxazol-3-yl)-N,N-dipropylacetamide?
2-(2-oxo-5-phenyl-1,3-benzoxazol-3-yl)-N,N-dipropylacetamide has a molecular weight of 352.43 g/mol, XLogP of 3.91, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxo-5-phenyl-1,3-benzoxazol-3-yl)-N,N-dipropylacetamide is sourced from PubChem (CID 11198965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).