C20H36N4O2 — CID 111989671
1-[3-[di(propan-2-yl)amino]propyl]-3-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]guanidine (PubChem CID 111989671) has the molecular formula C20H36N4O2 and a molecular weight of 364.53 g/mol. Its IUPAC name is 1-[3-[di(propan-2-yl)amino]propyl]-3-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]guanidine.
| Compound Name | 1-[3-[di(propan-2-yl)amino]propyl]-3-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111989671 |
| Molecular Formula | C20H36N4O2 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | 1-[3-[di(propan-2-yl)amino]propyl]-3-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1O)NCCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C20H36N4O2/c1-7-21-20(22-12-9-13-24(15(2)3)16(4)5)23-14-17-10-8-11-18(26-6)19(17)25/h8,10-11,15-16,25H,7,9,12-14H2,1-6H3,(H2,21,22,23) |
| InChIKey | BXAHEMZJMNNMKS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|