C18H28ClF2N3O3 — CID 111990083
1-[2-(2-butoxyethoxy)ethyl]-3-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine (PubChem CID 111990083) has the molecular formula C18H28ClF2N3O3 and a molecular weight of 407.89 g/mol. Its IUPAC name is 1-[2-(2-butoxyethoxy)ethyl]-3-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[2-(2-butoxyethoxy)ethyl]-3-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111990083 |
| Molecular Formula | C18H28ClF2N3O3 |
| Molecular Weight | 407.89 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 1-[2-(2-butoxyethoxy)ethyl]-3-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine |
| SMILES | CCCCOCCOCCN/C(=N\C)NCc1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C18H28ClF2N3O3/c1-3-4-8-25-10-11-26-9-7-23-18(22-2)24-13-14-12-15(19)5-6-16(14)27-17(20)21/h5-6,12,17H,3-4,7-11,13H2,1-2H3,(H2,22,23,24) |
| InChIKey | WFCSWMPZLHAPFE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.89 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|