C14H28F3N3O — CID 111990871
2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 111990871) has the molecular formula C14H28F3N3O and a molecular weight of 311.39 g/mol. Its IUPAC name is 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 111990871 |
| Molecular Formula | C14H28F3N3O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CC(CC)(CC)CCO)NCCC(F)(F)F |
| InChI | InChI=1S/C14H28F3N3O/c1-4-13(5-2,8-10-21)11-20-12(18-6-3)19-9-7-14(15,16)17/h21H,4-11H2,1-3H3,(H2,18,19,20) |
| InChIKey | AWNMJSDVGOSZHR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|