About 6-chloro-2-(2,3-dichloroanilino)-1H-benzimidazole-4-carboxylic acid
6-chloro-2-(2,3-dichloroanilino)-1H-benzimidazole-4-carboxylic acid (PubChem CID 11199089) has the molecular formula C14H8Cl3N3O2
and a molecular weight of 356.60 g/mol. Its IUPAC name is 6-chloro-2-(2,3-dichloroanilino)-1H-benzimidazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 6-chloro-2-(2,3-dichloroanilino)-1H-benzimidazole-4-carboxylic acid |
| PubChem CID | 11199089 |
| Molecular Formula | C14H8Cl3N3O2 |
| Molecular Weight | 356.60 g/mol |
| Exact Mass | 354.97 |
| IUPAC Name | 6-chloro-2-(2,3-dichloroanilino)-1H-benzimidazole-4-carboxylic acid |
| SMILES | O=C(O)c1cc(Cl)cc2[nH]c(Nc3cccc(Cl)c3Cl)nc12 |
| InChI | InChI=1S/C14H8Cl3N3O2/c15-6-4-7(13(21)22)12-10(5-6)19-14(20-12)18-9-3-1-2-8(16)11(9)17/h1-5H,(H,21,22)(H2,18,19,20) |
| InChIKey | FDWCXDWDXDJBKT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-2-(2,3-dichloroanilino)-1H-benzimidazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-(2,3-dichloroanilino)-1H-benzimidazole-4-carboxylic acid?
The IUPAC name of 6-chloro-2-(2,3-dichloroanilino)-1H-benzimidazole-4-carboxylic acid (CID 11199089) is 6-chloro-2-(2,3-dichloroanilino)-1H-benzimidazole-4-carboxylic acid.
What is the SMILES notation for 6-chloro-2-(2,3-dichloroanilino)-1H-benzimidazole-4-carboxylic acid?
The canonical SMILES for 6-chloro-2-(2,3-dichloroanilino)-1H-benzimidazole-4-carboxylic acid is O=C(O)c1cc(Cl)cc2[nH]c(Nc3cccc(Cl)c3Cl)nc12.
What is the InChIKey of 6-chloro-2-(2,3-dichloroanilino)-1H-benzimidazole-4-carboxylic acid?
The InChIKey is FDWCXDWDXDJBKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl3N3O2/c15-6-4-7(13(21)22)12-10(5-6)19-14(20-12)18-9-3-1-2-8(16)11(9)17/h1-5H,(H,21,22)(H2,18,19,20).
What are the key properties of 6-chloro-2-(2,3-dichloroanilino)-1H-benzimidazole-4-carboxylic acid?
6-chloro-2-(2,3-dichloroanilino)-1H-benzimidazole-4-carboxylic acid has a molecular weight of 356.60 g/mol, XLogP of 4.96, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-(2,3-dichloroanilino)-1H-benzimidazole-4-carboxylic acid is sourced from PubChem (CID 11199089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).