C22H30FN5O — CID 111991365
1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-[1-(pyridin-2-ylmethyl)piperidin-4-yl]guanidine (PubChem CID 111991365) has the molecular formula C22H30FN5O and a molecular weight of 399.51 g/mol. Its IUPAC name is 1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-[1-(pyridin-2-ylmethyl)piperidin-4-yl]guanidine.
| Compound Name | 1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-[1-(pyridin-2-ylmethyl)piperidin-4-yl]guanidine |
|---|---|
| PubChem CID | 111991365 |
| Molecular Formula | C22H30FN5O |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 1-[2-(4-fluorophenoxy)propyl]-2-methyl-3-[1-(pyridin-2-ylmethyl)piperidin-4-yl]guanidine |
| SMILES | C/N=C(\NCC(C)Oc1ccc(F)cc1)NC1CCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C22H30FN5O/c1-17(29-21-8-6-18(23)7-9-21)15-26-22(24-2)27-19-10-13-28(14-11-19)16-20-5-3-4-12-25-20/h3-9,12,17,19H,10-11,13-16H2,1-2H3,(H2,24,26,27) |
| InChIKey | HDVSFYJGWMJTKV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|