C19H22N2O5 — CID 11199140
(3R)-3-hydroxy-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-(2-nitrophenyl)propanamide (PubChem CID 11199140) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is (3R)-3-hydroxy-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-(2-nitrophenyl)propanamide.
| Compound Name | (3R)-3-hydroxy-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-(2-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 11199140 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (3R)-3-hydroxy-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-(2-nitrophenyl)propanamide |
| SMILES | C[C@@H]([C@@H](O)c1ccccc1)N(C)C(=O)C[C@@H](O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H22N2O5/c1-13(19(24)14-8-4-3-5-9-14)20(2)18(23)12-17(22)15-10-6-7-11-16(15)21(25)26/h3-11,13,17,19,22,24H,12H2,1-2H3/t13-,17+,19+/m0/s1 |
| InChIKey | CXFRWHUTOSFHEL-BOFPYLFWSA-N |
| XLogP | 2.60 |
| TPSA | 103.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|