C17H30O6Si — CID 11199152
methyl (3aR,4S,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate (PubChem CID 11199152) has the molecular formula C17H30O6Si and a molecular weight of 358.51 g/mol. Its IUPAC name is methyl (3aR,4S,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl (3aR,4S,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 11199152 |
| Molecular Formula | C17H30O6Si |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | methyl (3aR,4S,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)C1=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2OC(C)(C)O[C@@H]2[C@H]1O |
| InChI | InChI=1S/C17H30O6Si/c1-16(2,3)24(7,8)23-11-9-10(15(19)20-6)12(18)14-13(11)21-17(4,5)22-14/h9,11-14,18H,1-8H3/t11-,12-,13-,14+/m0/s1 |
| InChIKey | IGAKEISXDKTFPO-XDQVBPFNSA-N |
| XLogP | 2.37 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|