C24H40N4O2 — CID 111991777
1-ethyl-3-[1-(2-methylpropanoyl)piperidin-4-yl]-2-[2-[4-(2-methylpropoxy)phenyl]ethyl]guanidine (PubChem CID 111991777) has the molecular formula C24H40N4O2 and a molecular weight of 416.61 g/mol. Its IUPAC name is 1-ethyl-3-[1-(2-methylpropanoyl)piperidin-4-yl]-2-[2-[4-(2-methylpropoxy)phenyl]ethyl]guanidine.
| Compound Name | 1-ethyl-3-[1-(2-methylpropanoyl)piperidin-4-yl]-2-[2-[4-(2-methylpropoxy)phenyl]ethyl]guanidine |
|---|---|
| PubChem CID | 111991777 |
| Molecular Formula | C24H40N4O2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.32 |
| IUPAC Name | 1-ethyl-3-[1-(2-methylpropanoyl)piperidin-4-yl]-2-[2-[4-(2-methylpropoxy)phenyl]ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1ccc(OCC(C)C)cc1)NC1CCN(C(=O)C(C)C)CC1 |
| InChI | InChI=1S/C24H40N4O2/c1-6-25-24(27-21-12-15-28(16-13-21)23(29)19(4)5)26-14-11-20-7-9-22(10-8-20)30-17-18(2)3/h7-10,18-19,21H,6,11-17H2,1-5H3,(H2,25,26,27) |
| InChIKey | LQJBALYJUPMUOE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|