C20H33N5O4S — CID 111991831
2-[3-[[[ethylamino-[(1-propylsulfonylpiperidin-4-yl)amino]methylidene]amino]methyl]phenoxy]acetamide (PubChem CID 111991831) has the molecular formula C20H33N5O4S and a molecular weight of 439.58 g/mol. Its IUPAC name is 2-[3-[[[ethylamino-[(1-propylsulfonylpiperidin-4-yl)amino]methylidene]amino]methyl]phenoxy]acetamide.
| Compound Name | 2-[3-[[[ethylamino-[(1-propylsulfonylpiperidin-4-yl)amino]methylidene]amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111991831 |
| Molecular Formula | C20H33N5O4S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 2-[3-[[[ethylamino-[(1-propylsulfonylpiperidin-4-yl)amino]methylidene]amino]methyl]phenoxy]acetamide |
| SMILES | CCCS(=O)(=O)N1CCC(N/C(=N/Cc2cccc(OCC(N)=O)c2)NCC)CC1 |
| InChI | InChI=1S/C20H33N5O4S/c1-3-12-30(27,28)25-10-8-17(9-11-25)24-20(22-4-2)23-14-16-6-5-7-18(13-16)29-15-19(21)26/h5-7,13,17H,3-4,8-12,14-15H2,1-2H3,(H2,21,26)(H2,22,23,24) |
| InChIKey | SKKKGXUDJOKHCE-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|