C17H30N4O3 — CID 111991887
1-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]-3-[1-(2-methoxyethyl)piperidin-4-yl]guanidine (PubChem CID 111991887) has the molecular formula C17H30N4O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]-3-[1-(2-methoxyethyl)piperidin-4-yl]guanidine.
| Compound Name | 1-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]-3-[1-(2-methoxyethyl)piperidin-4-yl]guanidine |
|---|---|
| PubChem CID | 111991887 |
| Molecular Formula | C17H30N4O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | 1-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]-3-[1-(2-methoxyethyl)piperidin-4-yl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccco1)NC1CCN(CCOC)CC1 |
| InChI | InChI=1S/C17H30N4O3/c1-3-18-17(19-13-15(22)16-5-4-11-24-16)20-14-6-8-21(9-7-14)10-12-23-2/h4-5,11,14-15,22H,3,6-10,12-13H2,1-2H3,(H2,18,19,20) |
| InChIKey | YIYXLTLHOYVAGM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|