C22H34O4 — CID 11199268
(4R,5R,6S)-4,5,6-trihydroxy-3-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one (PubChem CID 11199268) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is (4R,5R,6S)-4,5,6-trihydroxy-3-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one.
| Compound Name | (4R,5R,6S)-4,5,6-trihydroxy-3-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11199268 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (4R,5R,6S)-4,5,6-trihydroxy-3-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C[C@@]1(O)C(=O)C=C(C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H34O4/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-22(26)19(23)14-18(5)20(24)21(22)25/h8,10,12,14,20-21,24-26H,6-7,9,11,13H2,1-5H3/b16-10+,17-12+/t20-,21-,22-/m1/s1 |
| InChIKey | OAJBJWHLTFTYAG-LZSPVNHTSA-N |
| XLogP | 3.78 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|