C15H28F3N5O — CID 111992761
2-[4-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide (PubChem CID 111992761) has the molecular formula C15H28F3N5O and a molecular weight of 351.42 g/mol. Its IUPAC name is 2-[4-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide.
| Compound Name | 2-[4-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 111992761 |
| Molecular Formula | C15H28F3N5O |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 2-[4-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)CN1CCC(N/C(=N/C)NCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C15H28F3N5O/c1-3-7-20-13(24)11-23-9-4-12(5-10-23)22-14(19-2)21-8-6-15(16,17)18/h12H,3-11H2,1-2H3,(H,20,24)(H2,19,21,22) |
| InChIKey | XKPKQZPBUJUMIM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|